Introduction：Basic information about CAS 135380-39-1|1-(6-Benzyl-2,6-diazaspiro[3.4]oct-2-yl)ethanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(6-Benzyl-2,6-diazaspiro[3.4]oct-2-yl)ethanone |
|---|
| CAS Number | 135380-39-1 | Molecular Weight | 244.33200 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 393.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 171.5ºC |
|---|
Names
| Name | 1-(6-Benzyl-2,6-diazaspiro[3.4]oct-2-yl)ethanone |
|---|
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 393.6ºC at 760 mmHg |
|---|
| Molecular Formula | C15H20N2O |
|---|
| Molecular Weight | 244.33200 |
|---|
| Flash Point | 171.5ºC |
|---|
| Exact Mass | 244.15800 |
|---|
| PSA | 23.55000 |
|---|
| LogP | 1.61660 |
|---|
| Vapour Pressure | 2.1E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | ZSKLMVSQCKNENQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)N1CC2(CCN(Cc3ccccc3)C2)C1 |
|---|
