Introduction：Basic information about CAS 447406-77-1|ethyl 2-methyl-2-(2-methyl-4-sulfanyl-phenoxy)propanoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-methyl-2-(2-methyl-4-sulfanyl-phenoxy)propanoate |
|---|
| CAS Number | 447406-77-1 | Molecular Weight | 254.34500 |
|---|
| Density | 1.113g/cm3 | Boiling Point | 348.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 224.9ºC |
|---|
Names
| Name | ethyl 2-methyl-2-(2-methyl-4-sulfanyl-phenoxy)propanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.113g/cm3 |
|---|
| Boiling Point | 348.9ºC at 760 mmHg |
|---|
| Molecular Formula | C13H18O3S |
|---|
| Molecular Weight | 254.34500 |
|---|
| Flash Point | 224.9ºC |
|---|
| Exact Mass | 254.09800 |
|---|
| PSA | 74.33000 |
|---|
| LogP | 3.00420 |
|---|
| Index of Refraction | 1.532 |
|---|
| InChIKey | YVCDWJQGSCWPGH-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)C(C)(C)Oc1ccc(S)cc1C |
|---|
Synonyms
| 2-(4-N-maleimidophenyl)-6-methylbenzothiazole |
| 2-(4-Maleimidophenyl)-6-methylbenzothiazol |
| 2-(4-Maleimidophenyl)-6-methylbenzothiazole |
| 2-(4-mercapto-2-methyl-phenoxy)-2-methyl-propionic acid ethyl ester |
| 1-[4-(6-Methyl-benzothiazol-2-yl)-phenyl]-pyrrole-2,5-dione |
