Introduction：Basic information about CAS 162733-00-8|1-(3,4-Dichlorophenyl)cyclohexanecarboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(3,4-Dichlorophenyl)cyclohexanecarboxylic acid |
|---|
| CAS Number | 162733-00-8 | Molecular Weight | 273.155 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 414.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H14Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 204.3±28.7 °C |
|---|
Names
| Name | 1-(3,4-Dichlorophenyl)cyclohexanecarboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 414.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H14Cl2O2 |
|---|
| Molecular Weight | 273.155 |
|---|
| Flash Point | 204.3±28.7 °C |
|---|
| Exact Mass | 272.037079 |
|---|
| PSA | 37.30000 |
|---|
| LogP | 4.31 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | QEGCUNHOEAACFK-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)C1(c2ccc(Cl)c(Cl)c2)CCCCC1 |
|---|
Synonyms
| 3,4-dichloro-phenylbiguanide |
| 3,4-Dichlorphenylbiguanid |
| 1-(3,4-Dichlorophenyl)cyclohexanecarboxylic acid |
| 1-(3,4-dichlorophenyl)-1-cyclohexanecarboxylic acid |
| N-(3,4-dichlorophenyl)imidodicarbonimidic diamide |
| 1-(3,4-dichlorophenyl)-cyclohexanecarboxylic acid |
| 1-(3,4-Dichlor-phenyl)-biguanid |
| 1-(3,4-dichloro-phenyl)-biguanide |
| Cyclohexanecarboxylic acid, 1-(3,4-dichlorophenyl)- |
