Introduction：Basic information about CAS 25856-01-3|1-(4-Bromophenyl)-3-phenyl-1,3-propanedione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(4-Bromophenyl)-3-phenyl-1,3-propanedione |
|---|
| CAS Number | 25856-01-3 | Molecular Weight | 303.151 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 443.3±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H11BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 137.5±11.1 °C |
|---|
Names
| Name | 1-(4-bromophenyl)-3-phenylpropane-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 443.3±30.0 °C at 760 mmHg |
|---|
| Molecular Formula | C15H11BrO2 |
|---|
| Molecular Weight | 303.151 |
|---|
| Flash Point | 137.5±11.1 °C |
|---|
| Exact Mass | 301.994232 |
|---|
| PSA | 34.14000 |
|---|
| LogP | 3.81 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | IDQRBGOEWUVZGM-UHFFFAOYSA-N |
|---|
| SMILES | O=C(CC(=O)c1ccc(Br)cc1)c1ccccc1 |
|---|
Synonyms
| 4-Brom-dibenzoylmethan |
| 1-(4-bromo-phenyl)-3-phenyl-propane-1,3-dione |
| 1-(4-Bromophenyl)-3-phenyl-1,3-propanedione |
| 1,3-Propanedione, 1-(4-bromophenyl)-3-phenyl- |
| 1,3-Propanedione,1-(4-bromophenyl)-3-phenyl |
| 1-(4-Brom-phenyl)-3-phenyl-propan-1,3-dion |
