Introduction：Basic information about CAS 25412-75-3|4-Nitrobenzenecarboximidamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Nitrobenzenecarboximidamide |
|---|
| CAS Number | 25412-75-3 | Molecular Weight | 165.149 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 310.6±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7N3O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 141.6±28.4 °C |
|---|
Names
| Name | 4-nitrobenzenecarboximidamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 310.6±44.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H7N3O2 |
|---|
| Molecular Weight | 165.149 |
|---|
| Flash Point | 141.6±28.4 °C |
|---|
| Exact Mass | 165.053833 |
|---|
| PSA | 95.69000 |
|---|
| LogP | 0.61 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | RNYJYWQMEZWWPT-UHFFFAOYSA-N |
|---|
| SMILES | N=C(N)c1ccc([N+](=O)[O-])cc1 |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-Nitrobenzamidine |
| Benzenecarboximidamide, 4-nitro- |
| 4-Nitro-benzamidin |
| 3-O2NC6H4C(=NH)NH2 |
| EINECS 246-952-2 |
| Benzenecarboximidamide,4-nitro |
| 4-nitro-benzenecarboximidamide |
| p-nitrobenzamidine |
| 4-Nitrobenzenecarboximidamide |
