Introduction：Basic information about CAS 25753-16-6|4-(trifluoromethyl)benzoic anhydride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(trifluoromethyl)benzoic anhydride |
|---|
| CAS Number | 25753-16-6 | Molecular Weight | 362.22300 |
|---|
| Density | 1.427g/cm3 | Boiling Point | 390.6ºC at 760mmHg |
|---|
| Molecular Formula | C16H8F6O3 | Melting Point | 130 °C |
|---|
| MSDS | / | Flash Point | 183.5ºC |
|---|
Names
| Name | [4-(trifluoromethyl)benzoyl] 4-(trifluoromethyl)benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.427g/cm3 |
|---|
| Boiling Point | 390.6ºC at 760mmHg |
|---|
| Melting Point | 130 °C |
|---|
| Molecular Formula | C16H8F6O3 |
|---|
| Molecular Weight | 362.22300 |
|---|
| Flash Point | 183.5ºC |
|---|
| Exact Mass | 362.03800 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 4.72140 |
|---|
| Vapour Pressure | 2.61E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.486 |
|---|
| InChIKey | FNAWJOBKLWLHTA-UHFFFAOYSA-N |
|---|
| SMILES | O=C(OC(=O)c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
|---|
Safety Information
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| p-trifluoromethylthiobenzoic anhydride |
| 4-Trifluoromethylbenzoic anhydride |
| TFBA |
| 4-(trifluromethyl)benzoic anhydride |
| p-trifluoromethylbenzoic anhydride |
| MFCD00671577 |
| 4-(Trifluoromethyl)Benzoic Anhydride |
