Introduction:Basic information about CAS 134-85-0|4-Chlorobenzophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Chlorobenzophenone |
|---|
| CAS Number | 134-85-0 | Molecular Weight | 216.663 |
|---|
| Density | 1.2±0.1 g/cm3 | Boiling Point | 333.0±25.0 °C at 760 mmHg |
|---|
| Molecular Formula | C13H9ClO | Melting Point | 93-96 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 176.1±14.3 °C |
|---|
Names
| Name | 4-Chlorobenzophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2±0.1 g/cm3 |
|---|
| Boiling Point | 333.0±25.0 °C at 760 mmHg |
|---|
| Melting Point | 93-96 °C(lit.) |
|---|
| Molecular Formula | C13H9ClO |
|---|
| Molecular Weight | 216.663 |
|---|
| Flash Point | 176.1±14.3 °C |
|---|
| Exact Mass | 216.034195 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 3.90 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | UGVRJVHOJNYEHR-UHFFFAOYSA-N |
|---|
| SMILES | O=C(c1ccccc1)c1ccc(Cl)cc1 |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | C,Xi,Xn |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45-S24/25-S2637/39-S22 |
|---|
| RIDADR | UN 3261 8/PG 2 |
|---|
| WGK Germany | 2 |
|---|
| RTECS | AM5978800 |
|---|
| HS Code | 2914700090 |
|---|
Customs
| HS Code | 2914700090 |
|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-Chlorobenzophenone |
| chlorobenzophenone |
| 4-chloro-benzophenon |
| Methanone, (4-chlorophenyl)phenyl- |
| para-Chlorobenzophenone |
| MFCD00000625 |
| p-chlorobenzophenone |
| p-CBP |
| (4-Chlorophenyl)(phenyl)methanone |
| EINECS 208-631-5 |
| p-Chlorodiphenylketone |
| 4-Chlorodiphenylketone |
| 4-ClC6H4COPh |
| Cetirizine Impurity 7 |