Introduction：Basic information about CAS 312-21-0|4-(trifluoromethylsulfonyl)benzonitrile, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(trifluoromethylsulfonyl)benzonitrile |
|---|
| CAS Number | 312-21-0 | Molecular Weight | 235.18300 |
|---|
| Density | 1.54g/cm3 | Boiling Point | 322.4ºC at 760mmHg |
|---|
| Molecular Formula | C8H4F3NO2S | Melting Point | 89-94°C |
|---|
| MSDS | / | Flash Point | 148.8ºC |
|---|
Names
| Name | 4-(trifluoromethylsulfonyl)benzonitrile |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.54g/cm3 |
|---|
| Boiling Point | 322.4ºC at 760mmHg |
|---|
| Melting Point | 89-94°C |
|---|
| Molecular Formula | C8H4F3NO2S |
|---|
| Molecular Weight | 235.18300 |
|---|
| Flash Point | 148.8ºC |
|---|
| Exact Mass | 234.99100 |
|---|
| PSA | 66.31000 |
|---|
| LogP | 2.93258 |
|---|
| Index of Refraction | 1.543 |
|---|
| InChIKey | UHCGSMMNICMDIX-UHFFFAOYSA-N |
|---|
| SMILES | N#Cc1ccc(S(=O)(=O)C(F)(F)F)cc1 |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R22;R36/37/38 |
|---|
| Safety Phrases | S22-S36/37/39 |
|---|
| RIDADR | 3439 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1 |
|---|
| HS Code | 2926909090 |
|---|
Customs
| HS Code | 2926909090 |
|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 4-trifluoromethanesulphonylbenzonitrile |
| 4-[(trifluoromethyl)sulfonyl]benzenecarbonitrile |
| 4-Trifluormethansulfonyl-benzonitril |
| p-cyanophenyl trifluoromethyl sulfone |
| 4-trifluoromethanesulfonylbenzonitrile |
| MFCD01631631 |
| 4-[(trifluoromethyl)sulfonyl] benzonitrile |
