Introduction：Basic information about CAS 31795-44-5|5-formyl-2-furansulfonic acid sodium salt hydrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-formyl-2-furansulfonic acid sodium salt hydrate |
|---|
| CAS Number | 31795-44-5 | Molecular Weight | 198.12900 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C5H3NaO5S | Melting Point | >300°C |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | sodium,5-formylfuran-2-sulfonate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | >300°C |
|---|
| Molecular Formula | C5H3NaO5S |
|---|
| Molecular Weight | 198.12900 |
|---|
| Exact Mass | 197.96000 |
|---|
| PSA | 95.79000 |
|---|
| LogP | 1.07700 |
|---|
| InChIKey | ZTJAVDOZUQPVAV-UHFFFAOYSA-M |
|---|
| SMILES | O=Cc1ccc(S(=O)(=O)[O-])o1.[Na+] |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S22-S24/25-S36-S26 |
|---|
| HS Code | 2932190090 |
|---|
Customs
| HS Code | 2932190090 |
|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 5-Formyl-2-furansulfonsaeure-natriumsalz |
| MFCD08061349 |
| sodium 5-formylfuran-2-sulfonate |
| Sodium 5-Formyl-2-furansulfonate |
| sodium 2-formyl-furan-5-sulfonic acid |
| BB_SC-5424 |
| 5-Formylfuran-2-sulfonic acid sodium salt |
| 5-Formyl-2-furansulfonic Acid Sodium Salt |
| Furfural-5-sulfonic acid sodium salt |
| 5-formyl-2-furanosulfonic acid sodium salt |
| Sodium 5-formylfuran-2-sulphonate |
| sodium 5-methanoylfuran-2-sulfonate |
| EINECS 250-810-5 |
