Introduction：Basic information about CAS 31770-79-3|Meglucycline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Meglucycline |
|---|
| CAS Number | 31770-79-3 | Molecular Weight | 635.61600 |
|---|
| Density | 1.65g/cm3 | Boiling Point | 1000.3ºC at 760mmHg |
|---|
| Molecular Formula | C29H37N3O13 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 558.8ºC |
|---|
Names
| Name | 4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-N-[[[2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]methyl]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.65g/cm3 |
|---|
| Boiling Point | 1000.3ºC at 760mmHg |
|---|
| Molecular Formula | C29H37N3O13 |
|---|
| Molecular Weight | 635.61600 |
|---|
| Flash Point | 558.8ºC |
|---|
| Exact Mass | 635.23300 |
|---|
| PSA | 269.81000 |
|---|
| Index of Refraction | 1.72 |
|---|
| InChIKey | RTXXZBOFRSQDMC-UHFFFAOYSA-N |
|---|
| SMILES | CN(C)C1C(=O)C(C(=O)NCNC2C(O)OC(CO)C(O)C2O)=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4C(C)(O)C3CC12 |
|---|
Synonyms
| UNII-1172Y38G55 |
| Neoprodesciclina |
| Meglucyclin |
| Bioplan |
| MMC 3588 |
| Meglucycline |
