Introduction：Basic information about CAS 167096-99-3|benzyl (3S,4R)-3,4-dihydroxypiperidine-1-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | benzyl (3S,4R)-3,4-dihydroxypiperidine-1-carboxylate |
|---|
| CAS Number | 167096-99-3 | Molecular Weight | 251.27800 |
|---|
| Density | 1.324g/cm3 | Boiling Point | 410.363ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.98ºC |
|---|
Names
| Name | benzyl (3S,4R)-3,4-dihydroxypiperidine-1-carboxylate |
|---|
Chemical & Physical Properties
| Density | 1.324g/cm3 |
|---|
| Boiling Point | 410.363ºC at 760 mmHg |
|---|
| Molecular Formula | C13H17NO4 |
|---|
| Molecular Weight | 251.27800 |
|---|
| Flash Point | 201.98ºC |
|---|
| Exact Mass | 251.11600 |
|---|
| PSA | 70.00000 |
|---|
| LogP | 0.68860 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.604 |
|---|
| InChIKey | RNUMISHXYWFZCE-NEPJUHHUSA-N |
|---|
| SMILES | O=C(OCc1ccccc1)N1CCC(O)C(O)C1 |
|---|
