Introduction：Basic information about CAS 1677-37-8|6-Fluoro-2,4-quinolinediol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Fluoro-2,4-quinolinediol |
|---|
| CAS Number | 1677-37-8 | Molecular Weight | 179.148 |
|---|
| Density | 1.5±0.1 g/cm3 | Boiling Point | 443.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6FNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 222.3±27.3 °C |
|---|
Names
| Name | 6-fluoro-4-hydroxy-1H-quinolin-2-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.5±0.1 g/cm3 |
|---|
| Boiling Point | 443.9±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H6FNO2 |
|---|
| Molecular Weight | 179.148 |
|---|
| Flash Point | 222.3±27.3 °C |
|---|
| Exact Mass | 179.038254 |
|---|
| PSA | 53.35000 |
|---|
| LogP | 2.40 |
|---|
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.708 |
|---|
| InChIKey | ZFBAAIYKVIMWHY-UHFFFAOYSA-N |
|---|
| SMILES | O=c1cc(O)c2cc(F)ccc2[nH]1 |
|---|
Safety Information
Customs
| HS Code | 2933499090 |
|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-Fluoro-2,4-quinolinediol |
| 6-FLUORO-2,4-DIHYDROXYQUINOLINE |
| 6-Fluoroquinoline-2,4-diol |
| 2,4-quinolinediol, 6-fluoro- |
| 6-fluoro-4-hydroxy-2-quinolon |
| 6-flouro-4-hydroxyl-2-quinolone |
| 6-Fluor-4-hydroxy-carbostyril |
