Introduction:Basic information about CAS 169674-00-4|6-Chloro-5-fluoro-1H-indole-2-carboxylic acid ethyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Chloro-5-fluoro-1H-indole-2-carboxylic acid ethyl ester |
|---|
| CAS Number | 169674-00-4 | Molecular Weight | 241.64600 |
|---|
| Density | 1.401 | Boiling Point | 380.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9ClFNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Methyl 6-chloro-5-fluoro-1H-indole-2-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.401 |
|---|
| Boiling Point | 380.6ºC at 760 mmHg |
|---|
| Molecular Formula | C11H9ClFNO2 |
|---|
| Molecular Weight | 241.64600 |
|---|
| Exact Mass | 241.03100 |
|---|
| PSA | 42.09000 |
|---|
| LogP | 3.13710 |
|---|
| Vapour Pressure | 5.39E-06mmHg at 25°C |
|---|
| Index of Refraction | 1.61 |
|---|
| InChIKey | KITAYCDBMMPIMA-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc2cc(F)c(Cl)cc2[nH]1 |
|---|
Synonyms
| Ethyl 6-chloro-5-fluoroindole-2-carboxylate |
| I10-0381 |
| 6-chloro-5-fluoro-1H-indole-2-carboxylic acid ethyl ester |
| ethyl 6-chloro-5-fluoro-1H-indole-2-carboxylate |