Introduction:Basic information about CAS 136207-26-6|Boc-D-phe(F5)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Boc-D-phe(F5)-OH |
|---|
| CAS Number | 136207-26-6 | Molecular Weight | 355.257 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 411.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14F5NO4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 202.4±28.7 °C |
|---|
Names
| Name | BOC-D-Pentafluorophenylalanine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 411.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C14H14F5NO4 |
|---|
| Molecular Weight | 355.257 |
|---|
| Flash Point | 202.4±28.7 °C |
|---|
| Exact Mass | 355.084290 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 3.15 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.476 |
|---|
| InChIKey | UZDKQMIDSLETST-ZCFIWIBFSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)NC(Cc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
|---|
| Storage condition | -15°C |
|---|
Safety Information
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
| 2,3,4,5,6-Pentafluoro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-D-phenylalanine |
| N-(tert-Butoxycarbonyl)-2,3,4,5,6-pentafluoro-L-phenylalanine |
| N-(tert-Butoxycarbonyl)-2,3,4,5,6-pentafluoro-D-phenylalanine |
| (R)-2-((tert-Butoxycarbonyl)amino)-3-(perfluorophenyl)propanoic acid |
| D-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2,3,4,5,6-pentafluoro- |
| Boc-D-2,3,4,5,6-Penta f luorophenylalanine |
| (2R)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(pentafluorophenyl)propanoic acid |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3-(pentafluorophenyl)propanoic acid |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-2,3,4,5,6-pentafluoro- |
| 2,3,4,5,6-Pentafluoro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-phenylalanine |
| Boc-D-phe(F5)-OH |
| (R)-2-(Boc-amino)-3-(pentafluorophenyl)propionic acid |
| MFCD00151892 |