Introduction：Basic information about CAS 136033-49-3|Nexopamil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nexopamil |
|---|
| CAS Number | 136033-49-3 | Molecular Weight | 404.58600 |
|---|
| Density | 0.985g/cm3 | Boiling Point | 514.7ºC at 760 mmHg |
|---|
| Molecular Formula | C24H40N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 265.1ºC |
|---|
Names
Chemical & Physical Properties
| Density | 0.985g/cm3 |
|---|
| Boiling Point | 514.7ºC at 760 mmHg |
|---|
| Molecular Formula | C24H40N2O3 |
|---|
| Molecular Weight | 404.58600 |
|---|
| Flash Point | 265.1ºC |
|---|
| Exact Mass | 404.30400 |
|---|
| PSA | 54.72000 |
|---|
| LogP | 5.42208 |
|---|
| Vapour Pressure | 1.06E-10mmHg at 25°C |
|---|
| Index of Refraction | 1.492 |
|---|
| InChIKey | SKDZEFVVFACNLS-DEOSSOPVSA-N |
|---|
| SMILES | CCCCCCN(C)CCCC(C#N)(c1cc(OC)c(OC)c(OC)c1)C(C)C |
|---|
