Introduction：Basic information about CAS 25827-12-7|Suloxifen, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Suloxifen |
|---|
| CAS Number | 25827-12-7 | Molecular Weight | 316.46100 |
|---|
| Density | 1.04g/cm3 | Boiling Point | 437.7ºC at 760mmHg |
|---|
| Molecular Formula | C18H24N2OS | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.5ºC |
|---|
Names
| Name | N,N-diethyl-2-[[oxo(diphenyl)-λ6-sulfanylidene]amino]ethanamine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.04g/cm3 |
|---|
| Boiling Point | 437.7ºC at 760mmHg |
|---|
| Molecular Formula | C18H24N2OS |
|---|
| Molecular Weight | 316.46100 |
|---|
| Flash Point | 218.5ºC |
|---|
| Exact Mass | 316.16100 |
|---|
| PSA | 41.05000 |
|---|
| LogP | 4.78010 |
|---|
| Vapour Pressure | 7.35E-08mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | HSOWGTFAGFRXKH-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCN=S(=O)(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| Sulfoximine,N-(2-(diethylamino)ethyl)-S,S-diphenyl |
| Suloxifen |
| N,N-Diaethylaminoaethyl-S,S-diphenyl-sulfoxim |
| N-(2-Diaethylamino-aethyl)-S,S-diphenyl-sulfoximin |
| Suloxifen [INN] |
| N-(2-Diaethylamino-aethyl)-S,S-diphenyl-sulfoximin-(1-14C) |
| N,N-diethyl-2-[[oxo(diphenyl) |
| N-(2-Diaethylamino-aethyl)-S,S-diphenyl-sulfoximin-(Phenyl-(U-14C)) |
| UNII-LD18TA6Q06 |
| N-(2-(Diethylamino)ethyl)-S,S-diphenylsulfoximine |
