Introduction:Basic information about CAS 25394-78-9|Cetoxime, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cetoxime |
|---|
| CAS Number | 25394-78-9 | Molecular Weight | 255.31500 |
|---|
| Density | 1.126g/cm3 | Boiling Point | 470.228ºC at 760 mmHg |
|---|
| Molecular Formula | C15H17N3O | Melting Point | 107-108° |
|---|
| MSDS | / | Flash Point | 238.186ºC |
|---|
Names
| Name | Cetoxime |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.126g/cm3 |
|---|
| Boiling Point | 470.228ºC at 760 mmHg |
|---|
| Melting Point | 107-108° |
|---|
| Molecular Formula | C15H17N3O |
|---|
| Molecular Weight | 255.31500 |
|---|
| Flash Point | 238.186ºC |
|---|
| Exact Mass | 255.13700 |
|---|
| PSA | 61.85000 |
|---|
| LogP | 3.13990 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.589 |
|---|
| InChIKey | GOAZMLKQUGCOPO-UHFFFAOYSA-N |
|---|
| SMILES | NC(CN(Cc1ccccc1)c1ccccc1)=NO |
|---|
Safety Information
Customs
| HS Code | 2925290090 |
|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Cetoximum |
| 2-N-Benzylanilinoacetamidoxime |
| 2-[Phenyl(phenylmethyl)amino]acetamide oxime |
| Cetoxima |
| 2-(N-Benzylanilino)acetamidoxin |