Introduction:Basic information about CAS 4406-22-8|Cyprenorphine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cyprenorphine |
|---|
| CAS Number | 4406-22-8 | Molecular Weight | 423.54500 |
|---|
| Density | 1.35g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C26H33NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Cyprenorphine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.35g/cm3 |
|---|
| Molecular Formula | C26H33NO4 |
|---|
| Molecular Weight | 423.54500 |
|---|
| Exact Mass | 423.24100 |
|---|
| PSA | 62.16000 |
|---|
| LogP | 3.10150 |
|---|
| Index of Refraction | 1.673 |
|---|
| InChIKey | VSKIOMHXEUHYSI-KNLIIKEYSA-N |
|---|
| SMILES | COC12C=CC3(CC1C(C)(C)O)C1Cc4ccc(O)c5c4C3(CCN1CC1CC1)C2O5 |
|---|
Synonyms
| CYPHOS(R) 443 |
| Phosphonium,tetrabutyl-,chloride |
| N-Cyclopropylmethyl-19-methylnororvinol |
| [Bu4P](1+)Cl(1-) |
| Tetra-N-butylphosphonium chloride |
| Tetrabutylphosphonium chloride |