Introduction:Basic information about CAS 13258-68-9|Ethynylestradiol Diacetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethynylestradiol Diacetate |
|---|
| CAS Number | 13258-68-9 | Molecular Weight | 416.50700 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 476.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H32O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 233ºC |
|---|
Names
| Name | Ethynyl Estradiol Diacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 476.9ºC at 760 mmHg |
|---|
| Molecular Formula | C24H32O6 |
|---|
| Molecular Weight | 416.50700 |
|---|
| Flash Point | 233ºC |
|---|
| Exact Mass | 416.22000 |
|---|
| PSA | 104.06000 |
|---|
| LogP | 4.05490 |
|---|
| Vapour Pressure | 2.94E-09mmHg at 25°C |
|---|
| Index of Refraction | 1.572 |
|---|
| InChIKey | UQWZWQYTKPEDAK-DJCPXJLLSA-N |
|---|
| SMILES | C#CC1(OC(C)=O)CCC2C3CCc4cc(OC(C)=O)ccc4C3CCC21C |
|---|
Synonyms
| Ethynylestradiol Diacetate |
| (8R)-3,17c-Diacetoxy-13c-methyl-17t-aethinyl-(8rH.9tH.14tH)-7.8.9.11.12.13.14.15.16.17-decahydro-6H-cyclopenta[a]phenanthren |
| 19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol 3,17-Diacetate |
| (17a)-19-Norpregna-1,3,5(10)-trien-20-yne-3,17-diol Diacetate |
| 17a-Ethynylestradiol 3,17-Diacetate |