Introduction：Basic information about CAS 315-13-9|1-fluoro-3,5-dimethyl-2-nitrobenzene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-fluoro-3,5-dimethyl-2-nitrobenzene |
|---|
| CAS Number | 315-13-9 | Molecular Weight | 169.15300 |
|---|
| Density | 1.225g/cm3 | Boiling Point | 260.7ºC at 760mmHg |
|---|
| Molecular Formula | C8H8FNO2 | Melting Point | 54-57ºC |
|---|
| MSDS | ChineseUSA | Flash Point | 111.4ºC |
|---|
Names
| Name | 1-fluoro-3,5-dimethyl-2-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.225g/cm3 |
|---|
| Boiling Point | 260.7ºC at 760mmHg |
|---|
| Melting Point | 54-57ºC |
|---|
| Molecular Formula | C8H8FNO2 |
|---|
| Molecular Weight | 169.15300 |
|---|
| Flash Point | 111.4ºC |
|---|
| Exact Mass | 169.05400 |
|---|
| PSA | 45.82000 |
|---|
| LogP | 2.87390 |
|---|
| Index of Refraction | 1.527 |
|---|
| InChIKey | XGLWCYVNZDSDNQ-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(F)c1 |
|---|
Synonyms
| 1-Fluor-3,5-dimethyl-2-nitro-benzol |
| 1-Fluor-2-nitro-3,5-dimethyl-benzol |
| 1-fluoro-3,5-dimethyl-2-nitro-benzene |
| 4,6-Dimethyl-2-fluoronitrobenzene |
| m-Xylene,5-fluoro-4-nitro-(6CI,7CI,8CI) |
| Benzene,1-fluoro-3,5-dimethyl-2-nitro |
| 2,4-dimethyl-6-fluoronitrobenzene |
