Introduction:Basic information about CAS 13479-54-4|Copper glycinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Copper glycinate |
|---|
| CAS Number | 13479-54-4 | Molecular Weight | 211.663 |
|---|
| Density | 4.39 | Boiling Point | 1200 °C |
|---|
| Molecular Formula | C4H8CuN2O4 | Melting Point | 1170 °C |
|---|
| MSDS | / | Flash Point | >1200°C |
|---|
Names
| Name | Copper glycinate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 4.39 |
|---|
| Boiling Point | 1200 °C |
|---|
| Melting Point | 1170 °C |
|---|
| Molecular Formula | C4H8CuN2O4 |
|---|
| Molecular Weight | 211.663 |
|---|
| Flash Point | >1200°C |
|---|
| Exact Mass | 210.978012 |
|---|
| PSA | 104.64000 |
|---|
| Vapour Pressure | 0.0123mmHg at 25°C |
|---|
| InChIKey | PCWPJANDNWWUAA-UHFFFAOYSA-N |
|---|
| SMILES | [Cu+2].[NH-]CC(=O)O.[NH-]CC(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi,T |
|---|
| Risk Phrases | R31:Contact with acids liberates toxic gas. R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN2923 |
|---|
| WGK Germany | 3 |
|---|
| Packaging Group | II |
|---|
| Hazard Class | 8 |
|---|
| HS Code | 2931900090 |
|---|
Customs
| HS Code | 2931900090 |
|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| (Cu(2+)-(gly)2) |
| GLYCINE CUPRIC SALT |
| EINECS 236-783-2 |
| MFCD00065114 |
| glycine,copper salt |
| Cu(glycine)2 |
| bis-glycinatocopper(II) |
| Copper(II) biglycinate |
| Glycine, copper(2+) salt (2:1) |
| Copper Glycinate |
| Copper(2+) bis(aminoacetate) |
| Cupric aminoacetate |
| Copper aminoacetate |
| Copper(II) diglycinate |
| bis(glycinato)copper |
| Copper Glycine |
| Copper(II) glycinate |
| Cupric bisglycinate |
| Copper(glycine)2 |
| copperdiglycinate |
| Cu(glycinate)2 |
| Copper diglycinate |
| cupric glycinate |