Introduction：Basic information about CAS 25279-63-4|Cholesteryl 3,5-Dinitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Cholesteryl 3,5-Dinitrobenzoate |
|---|
| CAS Number | 25279-63-4 | Molecular Weight | 580.75500 |
|---|
| Density | 1.17g/cm3 | Boiling Point | 649.1ºC at 760mmHg |
|---|
| Molecular Formula | C34H48N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 200.7ºC |
|---|
Names
| Name | [10,13-Dimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] 3,5-dinitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.17g/cm3 |
|---|
| Boiling Point | 649.1ºC at 760mmHg |
|---|
| Molecular Formula | C34H48N2O6 |
|---|
| Molecular Weight | 580.75500 |
|---|
| Flash Point | 200.7ºC |
|---|
| Exact Mass | 580.35100 |
|---|
| PSA | 117.94000 |
|---|
| LogP | 10.11620 |
|---|
| Vapour Pressure | 9.87E-17mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | HHGUYYDVBVJLCU-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)CCCC(C)C1CCC2C3CC=C4CC(OC(=O)c5cc([N+](=O)[O-])cc([N+](=O)[O-])c5)CCC4(C)C3CCC12C |
|---|
Synonyms
| Cholesterol 3,5-dinitrobenzoate |
| Cholest-5-en-3-ol (3beta)-,3,5-dinitrobenzoate |
| 3beta-cholest-5-en-3-ol 3,5-dinitrobenzoate |
| Cholest-5-en-3-ol (3beta)-,3-(3,5-dinitrobenzoate) |
| cholesteryl 3,5-dinitrobenzoate |
| O-(3.5-Dinitro-benzoyl)-cholesterin |
