Introduction:Basic information about CAS 2516-95-2|5-Chloro-2-nitrobenzoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-Chloro-2-nitrobenzoic acid |
|---|
| CAS Number | 2516-95-2 | Molecular Weight | 201.564 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 362.0±27.0 °C at 760 mmHg |
|---|
| Molecular Formula | C7H4ClNO4 | Melting Point | 137-139 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 172.8±23.7 °C |
|---|
| Symbol | GHS05, GHS07, GHS09 | Signal Word | Danger |
|---|
Names
| Name | 5-Chloro-2-nitrobenzoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 362.0±27.0 °C at 760 mmHg |
|---|
| Melting Point | 137-139 °C(lit.) |
|---|
| Molecular Formula | C7H4ClNO4 |
|---|
| Molecular Weight | 201.564 |
|---|
| Flash Point | 172.8±23.7 °C |
|---|
| Exact Mass | 200.982880 |
|---|
| PSA | 83.12000 |
|---|
| LogP | 2.62 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.628 |
|---|
| InChIKey | ZKUYSJHXBFFGPU-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cc(Cl)ccc1[N+](=O)[O-] |
|---|
| Water Solubility | SLIGHTLY SOLUBLE |
|---|
Safety Information
| Symbol | GHS05, GHS07, GHS09 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H302-H315-H318-H335-H400 |
|---|
| Precautionary Statements | P261-P273-P280-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi:Irritant |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S22-S24/25-S61-S60-S36/37/39-S26 |
|---|
| RIDADR | UN3077 9/PG 3 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 29163900 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 5-chloro-2-nitro benzoic acid |
| EINECS 219-738-1 |
| MFCD00007290 |
| Benzoic acid,5-chloro-2-nitro |
| 4-chloro-1-nitrobenzoic acid |
| 5-Chloro-2-nitrobenzoic acid |
| 2-nitro-5-chlorobenzoic acid |
| Benzoic acid, 5-chloro-2-nitro- |
| 3-chloro-6-nitrobenzoic acid |