Introduction：Basic information about CAS 36817-57-9|1-(2-ethoxyphenyl)pyrrole-2,5-dione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(2-ethoxyphenyl)pyrrole-2,5-dione |
|---|
| CAS Number | 36817-57-9 | Molecular Weight | 217.22100 |
|---|
| Density | 1.272g/cm3 | Boiling Point | 354.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.1ºC |
|---|
Names
| Name | 1-(2-ethoxyphenyl)pyrrole-2,5-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.272g/cm3 |
|---|
| Boiling Point | 354.4ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11NO3 |
|---|
| Molecular Weight | 217.22100 |
|---|
| Flash Point | 168.1ºC |
|---|
| Exact Mass | 217.07400 |
|---|
| PSA | 46.61000 |
|---|
| LogP | 1.57970 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | RRXDDBJMCPRNNO-UHFFFAOYSA-N |
|---|
| SMILES | CCOc1ccccc1N1C(=O)C=CC1=O |
|---|
Safety Information
Customs
| HS Code | 2925190090 |
|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| ethoxyphenylmaleimide |
| ethyl ethoxy(phenyl)acetate |
| N-o-Ethoxyphenylmaleamid |
| N-(2-ethoxyphenyl)maleimide |
| ethoxyphenylacetic acid ethyl ester |
| Aethoxy-phenyl-essigsaeure-aethylester |
