Introduction：Basic information about CAS 137694-75-8|D-NMMA (acetate), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-NMMA (acetate) |
|---|
| CAS Number | 137694-75-8 | Molecular Weight | 248.279 |
|---|
| Density | 1.2162 (rough estimate) | Boiling Point | 392.7ºC at 760mmHg |
|---|
| Molecular Formula | C9H20N4O4 | Melting Point | 180ºC |
|---|
| MSDS | / | Flash Point | 191.3ºC |
|---|
Names
| Name | D-NMMA (acetate) |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2162 (rough estimate) |
|---|
| Boiling Point | 392.7ºC at 760mmHg |
|---|
| Melting Point | 180ºC |
|---|
| Molecular Formula | C9H20N4O4 |
|---|
| Molecular Weight | 248.279 |
|---|
| Flash Point | 191.3ºC |
|---|
| Exact Mass | 248.148453 |
|---|
| PSA | 148.53000 |
|---|
| LogP | 0.59500 |
|---|
| Vapour Pressure | 2.92E-07mmHg at 25°C |
|---|
| Index of Refraction | 1.6300 (estimate) |
|---|
| InChIKey | NTNWOCRCBQPEKQ-RXMQYKEDSA-O |
|---|
| SMILES | CN=C(N)NCCCC([NH3+])C(=O)O |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
Synonyms
| nw-methyl-d-arginine acetate |
| ng-methyl-d-arginine acetate |
| d-nmma monoacetate |
| MFCD00083440 |
| ng-me-d-arg,acoh |
| ng-monomethyl-d-arginine acetate |
| N-(N'-Methylcarbamimidoyl)ornithine acetate (1:1) |
| d-nmma |
| d-nmma,monoacetate salt |
| Ornithine, N-[(E)-amino(methylimino)methyl]-, acetate (1:1) |
| d-nmma,acetate salt |
