Introduction：Basic information about CAS 31980-29-7|Nicofibrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Nicofibrate |
|---|
| CAS Number | 31980-29-7 | Molecular Weight | 305.75600 |
|---|
| Density | 1.228g/cm3 | Boiling Point | 421.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H16ClNO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 208.9ºC |
|---|
Names
| Name | 3-Pyridinylmethyl 2-(4-chlorophenoxy)-2-methylpropanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.228g/cm3 |
|---|
| Boiling Point | 421.9ºC at 760mmHg |
|---|
| Molecular Formula | C16H16ClNO3 |
|---|
| Molecular Weight | 305.75600 |
|---|
| Flash Point | 208.9ºC |
|---|
| Exact Mass | 305.08200 |
|---|
| PSA | 48.42000 |
|---|
| LogP | 3.63580 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | RARQHAFNGNPQCZ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)OCc1cccnc1 |
|---|
Synonyms
| 2-(4-chloro-phenoxy)-2-methyl-propionic acid pyridin-3-ylmethyl ester |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide monohydrate |
| nicofibrate |
| 5-chlorosalicyl-(2-chloro-4-nitro)anilide monohydrate |
| 2',5-D733ichloro-4'-nitrosalicylanilide Hydrate |
| Cestocide |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide Hydrate |
| Niclosamide monohydrate |
