Introduction：Basic information about CAS 130705-31-6|Bruceine I, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Bruceine I |
|---|
| CAS Number | 130705-31-6 | Molecular Weight | 436.45200 |
|---|
| Density | 1.48g/cm3 | Boiling Point | 674.6ºC at 760mmHg |
|---|
| Molecular Formula | C22H28O9 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Boiling Point | 674.6ºC at 760mmHg |
|---|
| Molecular Formula | C22H28O9 |
|---|
| Molecular Weight | 436.45200 |
|---|
| Flash Point | 235.7ºC |
|---|
| Exact Mass | 436.17300 |
|---|
| PSA | 139.59000 |
|---|
| LogP | 0.41920 |
|---|
| Vapour Pressure | 4.31E-21mmHg at 25°C |
|---|
| Index of Refraction | 1.617 |
|---|
| InChIKey | CMVMKMSNNMBUMZ-UTQVZMMYSA-N |
|---|
| SMILES | CCOC(=O)C12OCC34C(CC5C(C)=C(O)C(=O)CC5(C)C3C(O)C1O)OC(=O)CC24 |
|---|
