Introduction：Basic information about CAS 36144-08-8|mantabegron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | mantabegron |
|---|
| CAS Number | 36144-08-8 | Molecular Weight | 301.42300 |
|---|
| Density | 1.15g/cm3 | Boiling Point | 465.9ºC at 760mmHg |
|---|
| Molecular Formula | C19H27NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.6ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.15g/cm3 |
|---|
| Boiling Point | 465.9ºC at 760mmHg |
|---|
| Molecular Formula | C19H27NO2 |
|---|
| Molecular Weight | 301.42300 |
|---|
| Flash Point | 235.6ºC |
|---|
| Exact Mass | 301.20400 |
|---|
| PSA | 41.49000 |
|---|
| LogP | 3.37560 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | OVHWFGPUZGJWAI-UHFFFAOYSA-N |
|---|
| SMILES | OC(CNC12CC3CC(CC(C3)C1)C2)COc1ccccc1 |
|---|
