Introduction：Basic information about CAS 135821-54-4|Ceftizoxime alapivoxil, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ceftizoxime alapivoxil |
|---|
| CAS Number | 135821-54-4 | Molecular Weight | 568.62300 |
|---|
| Density | 1.56 | Boiling Point | / |
|---|
| Molecular Formula | C22H28N6O8S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | Ceftizoxime alapivoxil |
|---|
Chemical & Physical Properties
| Density | 1.56 |
|---|
| Molecular Formula | C22H28N6O8S2 |
|---|
| Molecular Weight | 568.62300 |
|---|
| Exact Mass | 568.14100 |
|---|
| PSA | 245.15000 |
|---|
| LogP | 1.25520 |
|---|
| Index of Refraction | 1.686 |
|---|
| InChIKey | VOPANQNVVCPHQR-UVHMKAGCSA-N |
|---|
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)OCOC(=O)C(C)(C)C)=CCSC12)c1csc(NC(=O)C(C)N)n1 |
|---|
