Introduction：Basic information about CAS 61799-13-1|3-Pyridinecarbonitrile, 5-(2-cyano-4-nitrophenyl)azo-2-(2-hydroxyethyl)amino-4-methyl, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-Pyridinecarbonitrile, 5-(2-cyano-4-nitrophenyl)azo-2-(2-hydroxyethyl)amino-4-methyl-6-3-(2-phenoxyethoxy)propylamino- |
|---|
| CAS Number | 61799-13-1 | Molecular Weight | 544.56200 |
|---|
| Density | 1.31g/cm3 | Boiling Point | 838.6ºC at 760 mmHg |
|---|
| Molecular Formula | C27H28N8O5 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 461ºC |
|---|
Names
| Name | 5-[(2-cyano-4-nitrophenyl)diazenyl]-2-(2-hydroxyethylamino)-4-methyl-6-[3-(2-phenoxyethoxy)propylamino]pyridine-3-carbonitrile |
|---|
Chemical & Physical Properties
| Density | 1.31g/cm3 |
|---|
| Boiling Point | 838.6ºC at 760 mmHg |
|---|
| Molecular Formula | C27H28N8O5 |
|---|
| Molecular Weight | 544.56200 |
|---|
| Flash Point | 461ºC |
|---|
| Exact Mass | 544.21800 |
|---|
| PSA | 196.99000 |
|---|
| LogP | 4.77686 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | DVEIMOJTBVDUFY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C#N)c(NCCO)nc(NCCCOCCOc2ccccc2)c1N=Nc1ccc([N+](=O)[O-])cc1C#N |
|---|
