Introduction：Basic information about CAS 61982-14-7|1H-Imidazole-5-carbonylchloride,1-methyl-4-nitro-(9CI), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H-Imidazole-5-carbonylchloride,1-methyl-4-nitro-(9CI) |
|---|
| CAS Number | 61982-14-7 | Molecular Weight | 189.55700 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C5H4ClN3O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 3-methyl-5-nitroimidazole-4-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Molecular Formula | C5H4ClN3O3 |
|---|
| Molecular Weight | 189.55700 |
|---|
| Exact Mass | 188.99400 |
|---|
| PSA | 80.71000 |
|---|
| LogP | 1.23050 |
|---|
| InChIKey | ICFIZGHDNGGJLG-UHFFFAOYSA-N |
|---|
| SMILES | Cn1cnc([N+](=O)[O-])c1C(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2933290090 |
|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 3-Methyl-5-nitro-3H-imidazol-4-carbonylchlorid |
| 1-methyl-4-nitroimidazole-5-carboxylic acid chloride |
| 1-methyl-4-nitroimidazolyl-5-carboxylic acid chloroanhydride |
| 1-methyl-4-nitro-1H-imidazole-5-carbonyl chloride |
| 3-methyl-5-nitro-3H-imidazole-4-carbonyl chloride |
