Introduction：Basic information about CAS 2589-00-6|2-(diethylamino)ethyl 2,2-diphenylpropanoate,hydrochloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(diethylamino)ethyl 2,2-diphenylpropanoate,hydrochloride |
|---|
| CAS Number | 2589-00-6 | Molecular Weight | 361.90600 |
|---|
| Density | 1.041g/cm3 | Boiling Point | 434.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H28ClNO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 132.5ºC |
|---|
Names
| Name | 2-(diethylamino)ethyl 2,2-diphenylpropanoate,hydrochloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.041g/cm3 |
|---|
| Boiling Point | 434.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H28ClNO2 |
|---|
| Molecular Weight | 361.90600 |
|---|
| Flash Point | 132.5ºC |
|---|
| Exact Mass | 361.18100 |
|---|
| PSA | 29.54000 |
|---|
| LogP | 4.67960 |
|---|
| Vapour Pressure | 9.24E-08mmHg at 25°C |
|---|
| InChIKey | UKPBAERJQQMCIP-UHFFFAOYSA-N |
|---|
| SMILES | CCN(CC)CCOC(=O)C(C)(c1ccccc1)c1ccccc1.Cl |
|---|
Safety Information
Customs
| HS Code | 2922199090 |
|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 2,2-Diphenylpropionic acid 2-(diethylamino)ethyl ester hydrochloride |
| Aprophen hydrochloride |
| Aprofen hydrochloride |
| 2-(diethylamino)ethyl 2,2-diphenylpropanoate hydrochloride(1:1) |
| Propionic acid,2,2-diphenyl-,2-(diethylamino)ethyl ester,hydrochloride |
| Aprofene HCl |
| Aprofene hydrochloride |
| 2-Diethylaminoethyl 2,2-diphenylpropionate hydrochloride |
| 2,2-Diphenyl-propionsaeure-(2-diaethylamino-aethylester),Hydrochlorid |
