Introduction:Basic information about CAS 25986-71-4|benzene-1,3-diol,formaldehyde,phenol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | benzene-1,3-diol,formaldehyde,phenol |
|---|
| CAS Number | 25986-71-4 | Molecular Weight | 234.24800 |
|---|
| Density | / | Boiling Point | 280ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 131.9ºC |
|---|
Names
| Name | benzene-1,3-diol,formaldehyde,phenol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 280ºC at 760 mmHg |
|---|
| Molecular Formula | C13H14O4 |
|---|
| Molecular Weight | 234.24800 |
|---|
| Flash Point | 131.9ºC |
|---|
| Exact Mass | 234.08900 |
|---|
| PSA | 77.76000 |
|---|
| LogP | 2.94100 |
|---|
| Vapour Pressure | 0.00229mmHg at 25°C |
|---|
| InChIKey | QDNBHWFDWXWFTG-UHFFFAOYSA-N |
|---|
| SMILES | C=O.Oc1cccc(O)c1.Oc1ccccc1 |
|---|
Synonyms
| Phenol,resorcin,formaldehyde resin |
| Resorcinol,formaldehyde,phenol polymer |
| Phenol,resorcin,formaldehyde polymer |
| Formaldehyde,polymer with 1,3-benzenediol and phenol |