Introduction：Basic information about CAS 13235-60-4|4-methoxyisophthaloyl dichloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methoxyisophthaloyl dichloride |
|---|
| CAS Number | 13235-60-4 | Molecular Weight | 233.04800 |
|---|
| Density | 1.401g/cm3 | Boiling Point | 344.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6Cl2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 151.9ºC |
|---|
Names
| Name | 4-methoxybenzene-1,3-dicarbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.401g/cm3 |
|---|
| Boiling Point | 344.5ºC at 760 mmHg |
|---|
| Molecular Formula | C9H6Cl2O3 |
|---|
| Molecular Weight | 233.04800 |
|---|
| Flash Point | 151.9ºC |
|---|
| Exact Mass | 231.96900 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.45320 |
|---|
| Vapour Pressure | 6.54E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.555 |
|---|
| InChIKey | FKPCRVTXBLUQBV-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc(C(=O)Cl)cc1C(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2917399090 |
|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| 4-Methoxy-isophthalsaeure-dichlorid |
| 4-Methoxy-isophthaloylchlorid |
| 4-methoxylisophthaloyl dichloride |
| 4-methoxy-isophthaloyl chloride |
| 1,3-Benzenedicarbonyldichloride,4-methoxy |
| 4-methoxy-1,3-benzenedicarbonyl dichloride |
| EINECS 236-209-0 |
| 4-methoxy-1,3-dicarboxylic acid dichloride |
| 4-Methoxyisophthaloyl dichloride |
| 4-Methoxyisophthaloyldichlorid |
