Introduction：Basic information about CAS 165120-40-1|2-Bromo-4'-chloroacetophenone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Bromo-4'-chloroacetophenone |
|---|
| CAS Number | 165120-40-1 | Molecular Weight | 233.490 |
|---|
| Density | 1.6±0.1 g/cm3 | Boiling Point | 289.7±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6BrClO | Melting Point | / |
|---|
| MSDS | / | Flash Point | 129.0±20.4 °C |
|---|
Names
| Name | 2-Bromo-4'-chloroacetophenone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.6±0.1 g/cm3 |
|---|
| Boiling Point | 289.7±15.0 °C at 760 mmHg |
|---|
| Molecular Formula | C8H6BrClO |
|---|
| Molecular Weight | 233.490 |
|---|
| Flash Point | 129.0±20.4 °C |
|---|
| Exact Mass | 231.929047 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 2.88 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.584 |
|---|
| InChIKey | IVBNBYJFBYVFEA-UHFFFAOYSA-N |
|---|
| SMILES | CCCCNc1c(N)c(Cl)nc2ccccc12 |
|---|
Synonyms
| N4-butyl-2-chloro-quinoline-3,4-diamine |
| α-Bromo-p-chloroacetophenone |
| 3-Amino-4-butyl-5-mercapto-1,2,4-triazol |
| 2-Bromo-1-(4-chlorophenyl)ethanone |
| Ethanone, 2-bromo-1- (4-chlorophenyl)- |
| Ethanone, 2-bromo-1-(4-chlorophenyl)- |
| 4-Butyl-5-imino-1,2,4-triazolidine-3-thione |
| α-Bromo-4'-chloroacetophenone |
| 3-amino-4-butylamino-2-chloroquinoline |
| 2-Bromo-4'-chloroacetophenone |
| α-Bromo-4-chloroacetophenone |
