Introduction：Basic information about CAS 2512-29-0|Pigment Yellow 1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Pigment Yellow 1 |
|---|
| CAS Number | 2512-29-0 | Molecular Weight | 340.333 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 546.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16N4O4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 284.3±30.1 °C |
|---|
Names
| Name | Fast Yellow G |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 546.5±50.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H16N4O4 |
|---|
| Molecular Weight | 340.333 |
|---|
| Flash Point | 284.3±30.1 °C |
|---|
| Exact Mass | 340.117157 |
|---|
| PSA | 119.87000 |
|---|
| LogP | 4.68 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.621 |
|---|
| InChIKey | MFYSUUPKMDJYPF-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(N=Nc1ccc(C)cc1[N+](=O)[O-])C(=O)Nc1ccccc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | R20/21/22 |
|---|
| Safety Phrases | S26-S36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| HS Code | 2927000090 |
|---|
Customs
| HS Code | 2927000090 |
|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Pigment Yellow 1 |
| kromonyellowg |
| lightyellow |
| 2-[(4-Methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenylbutanamide |
| HANSA YELLOW |
| EINECS 219-730-8 |
| 2-[(4-Methyl-2-nitrophenyl)azo]-3-oxo-N-phenylbutyramide Hansa Yellow G |
| Butanamide, 2-[2-(4-methyl-2-nitrophenyl)diazenyl]-3-oxo-N-phenyl- |
| fastyellowj |
| hansayellowgt |
| KI401 |
| MFCD00078234 |
| Hanza Yellow |
| fastyellowjt |
