Introduction:Basic information about CAS 1693-47-6|Tetramethyltetraphenylcyclotetrasiloxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tetramethyltetraphenylcyclotetrasiloxane |
|---|
| CAS Number | 1693-47-6 | Molecular Weight | 544.893 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 493.2±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H32O4Si4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 211.7±24.4 °C |
|---|
Names
| Name | 1,1,3,3-Tetramethyltetraphenylcyclotetrasiloxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 493.2±28.0 °C at 760 mmHg |
|---|
| Molecular Formula | C28H32O4Si4 |
|---|
| Molecular Weight | 544.893 |
|---|
| Flash Point | 211.7±24.4 °C |
|---|
| Exact Mass | 544.137756 |
|---|
| PSA | 36.92000 |
|---|
| LogP | 3.98320 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.577 |
|---|
| InChIKey | SOPXVWFVFREYPL-UHFFFAOYSA-N |
|---|
| SMILES | C[Si]1(C)O[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)O1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Tetramethyltetraphenylcyclotetrasiloxane |
| 1,3,5,7-Tetramethyl-1,3,5,7-tetraphenyl-cyclotetrasiloxane |
| Sym-tetramethyltetraphenylcyclotetrasiloxane |
| 2,2,4,4-Tetramethyl-6,6,8,8-tetraphenyl-1,3,5,7,2,4,6,8-tetroxatetrasilocane |
| Cyclotetrasiloxane, 2,2,4,4-tetramethyl-6,6,8,8-tetraphenyl- |
| 1,1,3,3-tetramethyl-5,5,7,7-tetraphenylcyclotetrasiloxane |
| Tetramethyltetraphenylcyclotetrasiloxan |
| Tetraphenyltetramethylcyclotetrasiloxane |
| 2,2,4,4-Tetramethyl-6,6,8,8-tetraphenylcyclotetrasiloxane |
| 1,1,3,3-Tetramethyl-5,5-7,7-tetraphenylcyclotetrasiloxan |