Introduction:Basic information about CAS 138164-12-2|BUTROXYDIM, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | BUTROXYDIM |
|---|
| CAS Number | 138164-12-2 | Molecular Weight | 399.523 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 535.9±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H33NO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 277.9±32.9 °C |
|---|
Names
| Name | butroxydim |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 535.9±60.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H33NO4 |
|---|
| Molecular Weight | 399.523 |
|---|
| Flash Point | 277.9±32.9 °C |
|---|
| Exact Mass | 399.240967 |
|---|
| PSA | 75.96000 |
|---|
| LogP | 5.53 |
|---|
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | ZOGDSYNXUXQGHF-BWAHOGKJSA-N |
|---|
| SMILES | CCCC(=O)c1c(C)cc(C)c(C2CC(=O)C(C(CC)=NOCC)=C(O)C2)c1C |
|---|
Safety Information
Synonyms
| (RS)-(EZ)-5-(3-Butyryl-2,4,6-trimethylphenyl)-2-(1-ethoxyiminopropyl)-3-hydroxycyclohex-2-en-1-one |
| 5-(3-Butyryl-2,4,6-trimethylphenyl)-2-[(1E)-N-ethoxypropanimidoyl]-3-hydroxycyclohex-2-en-1-one |
| (5RS)-5-(3-butyryl-2,4,6-trimethylphenyl)-2-[(EZ)-1-(ethoxyimino)propyl]-3-hydroxycyclohex-2-en-1-one |
| 2-[1-(ethoxyimino)propyl]-3-hydroxy-5-[2,4,6-trimethyl-3-(1-oxobutyl)phenyl]-2-cyclohexen-1-one |
| (5Ξ)-5-(3-butanoyl-2,4,6-trimethylphenyl)-2-[(1Ξ)-N-ethoxypropanimidoyl]-3-hydroxycyclohex-2-en-1-one |
| BUTROXYDIM |
| 5-(3-Butyryl-2,4,6-trimethylphenyl)-2-[(1E)-N-ethoxypropanimidoyl]-3-hydroxy-2-cyclohexen-1-one |
| 2-Cyclohexen-1-one, 2-[(1E)-1-(ethoxyimino)propyl]-3-hydroxy-5-[2,4,6-trimethyl-3-(1-oxobutyl)phenyl]- |
| 5-(3-butanoyl-2,4,6-trimethylphenyl)-2-[1-(ethoxyamino)propylidene]cyclohexane-1,3-dione |