CAS 3153-26-2|Vanadyl acetylacetonate
Introduction：Basic information about CAS 3153-26-2|Vanadyl acetylacetonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Vanadyl acetylacetonate | ||
|---|---|---|---|
| CAS Number | 3153-26-2 | Molecular Weight | 265.157 |
| Density | 1,4 g/cm3 | Boiling Point | 140°C 13mm |
| Molecular Formula | C10H14O5V | Melting Point | 235 °C (dec.)(lit.) |
| MSDS | ChineseUSA | Flash Point | 79 °C |
| Symbol | GHS07 | Signal Word | Warning |
Names
| Name | Vanadyl acetylacetonate |
|---|---|
| Synonym | More Synonyms |
Chemical & Physical Properties
| Density | 1,4 g/cm3 |
|---|---|
| Boiling Point | 140°C 13mm |
| Melting Point | 235 °C (dec.)(lit.) |
| Molecular Formula | C10H14O5V |
| Molecular Weight | 265.157 |
| Flash Point | 79 °C |
| Exact Mass | 265.028076 |
| PSA | 69.67000 |
| LogP | 1.80140 |
| InChIKey | GROXHKBCYOBDIM-FDGPNNRMSA-L |
| SMILES | CC(=O)C=C(C)[O-].CC(=O)C=C(C)[O-].[V+2] |
| Stability | Stable, but air sensitive. May discolour upon exposure to air. Incompatible with strong oxidizing agents. |
| Water Solubility | practically insoluble |
Safety Information
| Symbol | GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | 22-26-36-36/37/39 |
| RIDADR | 3285 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29420000 |
Customs
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
Articles6
More Articles| Design, synthesis and characterization of novel binary V(V)-Schiff base materials linked with insulin-mimetic vanadium-induced differentiation of 3T3-L1 fibroblasts to adipocytes. Structure-function correlations at the molecular level. J. Inorg. Biochem. 147 , 99-115, (2015) Among the various roles of vanadium in the regulation of intracellular signaling, energy metabolism and insulin mimesis, its exogenous activity stands as a contemporary challenge currently under inves... | |
| [Oxidation of phenothiazine and its N-methyl derivative by the combination of iodobenzene and vanadium acetylacetonate]. Pharmazie 40(3) , 202-3, (1985) | |
| X-ray fluorescence microscopy demonstrates preferential accumulation of a vanadium-based magnetic resonance imaging contrast agent in murine colonic tumors. Mol. Imaging 14 , (2015) Contrast agents that specifically enhance cancers on magnetic resonance imaging (MRI) will allow earlier detection. Vanadium-based chelates (VCs) selectively enhance rodent cancers on MRI, suggesting ... |
Synonyms
| Bis[(3Z)-4-(hydroxy-κO)-3-penten-2-onato](oxo)vanadium |
| Acetylacetone Vanadium(IV)oxy Salt |
| VANADYL PENTANEDIONATE |
| VANANDEYLACETYLACETONATE |
| VANADYL ACETYLACETONE |
| vanadium(IV)oxyacetylacetonate |
| Vanadyl acetylaceton |
| EINECS 221-590-8 |
| Vanadyl Acetylacetonate |
| Vanadium oxyacetoacetonate |
| oxobis(2,4-pentanedionato)vanadium(IV) |
| Bis[(3Z)-4-(hydroxy-κO)pent-3-en-2-onato](oxo)vanadium |
| VO(acac)2 (Vanadium(IV)-oxy acetylacetonate |
| VANADIUMOXY ACETYLACETONATE |
| Vanadium, bis[(3Z)-4-(hydroxy-κO)-3-penten-2-onato]oxo- |
| VO(acac)2 |
| bis(acetylacetonate)oxovanadium |
| Vanadyl(IV) acetylacetonate |
| Vanadium(IV)-oxy acetylacetonate |
| vanadium di(acetylacetonate) |
| V(IV)-oxyacetylacetonate |
| Vanadylacetylacetonate |
| Bis(2,4-pentanedionato)vanadium(IV) Oxide |
| Vanadium(IV)oxy Acetylacetonate |
| VANADYL 2,4-PENTANEDIONATE |
| MFCD00000032 |
| bis(acetylacetonato)oxovanadium |
| Vanadium(IV)oxy Acetyla |
