Introduction:Basic information about CAS 3608-11-5|herbal carene, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | herbal carene |
|---|
| CAS Number | 3608-11-5 | Molecular Weight | 178.27100 |
|---|
| Density | 0.957g/cm3 | Boiling Point | 236.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H18O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 89.7ºC |
|---|
Names
| Name | 1-(4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.957g/cm3 |
|---|
| Boiling Point | 236.2ºC at 760mmHg |
|---|
| Molecular Formula | C12H18O |
|---|
| Molecular Weight | 178.27100 |
|---|
| Flash Point | 89.7ºC |
|---|
| Exact Mass | 178.13600 |
|---|
| PSA | 17.07000 |
|---|
| LogP | 2.81380 |
|---|
| Index of Refraction | 1.483 |
|---|
| InChIKey | DXLORVVCLBWYCC-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C1CC2C(C=C1C)C2(C)C |
|---|
Synonyms
| 1-((1R,3R,6S)-7,7-dimethylbicyclo[4.1.0]hept-4-en-3-yl)ethanone |
| 3-acetyl-4,7,7-trimethylbicyclo[4.1.0]hept-4-ene |
| 1-(3,7,7-Trimethylbicyclo(4.1.0)heptenyl)ethanone |
| 1-(3,7,7-Trimethylbicyclo(4.1.0)heptenyl)ethan-1-one |
| EINECS 263-574-3 |
| 4-acetylcar-2-ene |
| (+)-1-{(1R,3R,6S)-4,7,7-trimethylbicyclo[4.1.0]hept-4-en-3-yl}ethan-1-one |
| 4-acetyl-2-carene |
| EINECS 222-771-4 |
| Ethanone,1-(4,7,7-trimethylbicyclo[4.1.0]hept-4-en-3-yl) |
| Acetylcarene |