Introduction：Basic information about CAS 610277-84-4|4-(2-chlorophenoxy)benzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-chlorophenoxy)benzenesulfonyl chloride |
|---|
| CAS Number | 610277-84-4 | Molecular Weight | 303.16100 |
|---|
| Density | 1.453g/cm3 | Boiling Point | 380.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl2O3S | Melting Point | 89-94 °C |
|---|
| MSDS | ChineseUSA | Flash Point | 183.7ºC |
|---|
| Symbol |
GHS05, GHS08 | Signal Word | Danger |
|---|
Names
| Name | 4-(2-chlorophenoxy)benzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.453g/cm3 |
|---|
| Boiling Point | 380.2ºC at 760 mmHg |
|---|
| Melting Point | 89-94 °C |
|---|
| Molecular Formula | C12H8Cl2O3S |
|---|
| Molecular Weight | 303.16100 |
|---|
| Flash Point | 183.7ºC |
|---|
| Exact Mass | 301.95700 |
|---|
| PSA | 51.75000 |
|---|
| LogP | 5.14060 |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | ILZBGLOVCXTRDS-UHFFFAOYSA-N |
|---|
| SMILES | O=S(=O)(Cl)c1ccc(Oc2ccccc2Cl)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol |
GHS05, GHS08 |
|---|
| Signal Word | Danger |
|---|
| Hazard Statements | H314-H370 |
|---|
| Precautionary Statements | P260-P280-P305 + P351 + P338-P310 |
|---|
| Hazard Codes | Xi |
|---|
| Safety Phrases | 26-36/37/39-45 |
|---|
| RIDADR | UN 3261 8 / PGII |
|---|
| HS Code | 2909309090 |
|---|
Customs
| HS Code | 2909309090 |
|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4PBS-S02-0 |
| F9995-0451 |
| AR1982 |
| 4-(2-Chloro-phenoxy)-benzenesulfonyl chloride |
