Introduction：Basic information about CAS 367-79-3|ethyl 2-fluoro-5-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | ethyl 2-fluoro-5-nitrobenzoate |
|---|
| CAS Number | 367-79-3 | Molecular Weight | 213.16300 |
|---|
| Density | 1.333g/cm3 | Boiling Point | 315.4ºC at 760mmHg |
|---|
| Molecular Formula | C9H8FNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 144.6ºC |
|---|
Names
| Name | ethyl 2-fluoro-5-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.333g/cm3 |
|---|
| Boiling Point | 315.4ºC at 760mmHg |
|---|
| Molecular Formula | C9H8FNO4 |
|---|
| Molecular Weight | 213.16300 |
|---|
| Flash Point | 144.6ºC |
|---|
| Exact Mass | 213.04400 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 2.43380 |
|---|
| Index of Refraction | 1.528 |
|---|
| InChIKey | UJIPWFPJAVYMHV-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1cc([N+](=O)[O-])ccc1F |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| 2-Fluor-5-nitrobenzoesaeure-aethylester |
| ethyl 2-fluoro-5-nitro-benzoate |
| ethylfluoronitrobenzenecarboxylate |
| 2-fluoro-5-nitro-benzoic acid ethyl ester |
| AB2841 |
