Introduction:Basic information about CAS 61640-16-2|CHEMBRDG-BB 5689234, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | CHEMBRDG-BB 5689234 |
|---|
| CAS Number | 61640-16-2 | Molecular Weight | 247.72000 |
|---|
| Density | 1.191g/cm3 | Boiling Point | 364ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14ClNO | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 174ºC |
|---|
Names
| Name | 4-(4-chloro-2-methylquinolin-3-yl)butan-2-one |
|---|
Chemical & Physical Properties
| Density | 1.191g/cm3 |
|---|
| Boiling Point | 364ºC at 760 mmHg |
|---|
| Molecular Formula | C14H14ClNO |
|---|
| Molecular Weight | 247.72000 |
|---|
| Flash Point | 174ºC |
|---|
| Exact Mass | 247.07600 |
|---|
| PSA | 29.96000 |
|---|
| LogP | 3.71820 |
|---|
| Index of Refraction | 1.595 |
|---|
| InChIKey | RJNCBNFDDJUWAS-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)CCc1c(C)nc2ccccc2c1Cl |
|---|