Introduction:Basic information about CAS 16104-50-0|1,3-dichloroadamantane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,3-dichloroadamantane |
|---|
| CAS Number | 16104-50-0 | Molecular Weight | 205.12400 |
|---|
| Density | 1.25 g/cm3 | Boiling Point | 276.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14Cl2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 118.8ºC |
|---|
Names
| Name | 1,3-dichloroadamantane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.25 g/cm3 |
|---|
| Boiling Point | 276.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14Cl2 |
|---|
| Molecular Weight | 205.12400 |
|---|
| Flash Point | 118.8ºC |
|---|
| Exact Mass | 204.04700 |
|---|
| LogP | 3.55540 |
|---|
| Vapour Pressure | 0.00815mmHg at 25°C |
|---|
| Index of Refraction | 1.549 |
|---|
| InChIKey | DZLCQHWJVJXVES-UHFFFAOYSA-N |
|---|
| SMILES | ClC12CC3CC(C1)CC(Cl)(C3)C2 |
|---|
Synonyms
| Adamantane,1,3-dichloro |
| 1,3-dichlorodamantane |
| 1,3-dichloradamantane |
| AmbscL01/020 |
| dichloroadamantane |
| 1,3-dichloro adamantane |