Introduction:Basic information about CAS 584-69-0|1-S,3-S-diethyl benzene-1,3-dicarbothioate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-S,3-S-diethyl benzene-1,3-dicarbothioate |
|---|
| CAS Number | 584-69-0 | Molecular Weight | 254.36800 |
|---|
| Density | 1.191g/cm3 | Boiling Point | 371.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O2S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 157.4ºC |
|---|
Names
| Name | 1-S,3-S-diethyl benzene-1,3-dicarbothioate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.191g/cm3 |
|---|
| Boiling Point | 371.9ºC at 760 mmHg |
|---|
| Molecular Formula | C12H14O2S2 |
|---|
| Molecular Weight | 254.36800 |
|---|
| Flash Point | 157.4ºC |
|---|
| Exact Mass | 254.04400 |
|---|
| PSA | 84.74000 |
|---|
| LogP | 3.47320 |
|---|
| Index of Refraction | 1.585 |
|---|
| InChIKey | DWGXUDUOJPYAOR-UHFFFAOYSA-N |
|---|
| SMILES | CCSC(=O)c1cccc(C(=O)SCC)c1 |
|---|
Synonyms
| Isophthalsaeure-bis-thiolethylester |
| Etusil |
| UNII-40SR2754GL |
| Ditophal |
| 1,3-Dithioisophthalic acid,diethyl ester |
| 1,3-dithio-isophthalic acid S,S'-diethyl ester |
| Etisul |
| 1,3-Dithio-isophthalsaeure-S,S'-diaethylester |