Introduction：Basic information about CAS 31221-85-9|Ibuverine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ibuverine |
|---|
| CAS Number | 31221-85-9 | Molecular Weight | 290.39700 |
|---|
| Density | 1.077g/cm3 | Boiling Point | 408.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H26O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 162ºC |
|---|
Names
| Name | 2-methylpropyl 2-cyclohexyl-2-hydroxy-2-phenylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.077g/cm3 |
|---|
| Boiling Point | 408.8ºC at 760 mmHg |
|---|
| Molecular Formula | C18H26O3 |
|---|
| Molecular Weight | 290.39700 |
|---|
| Flash Point | 162ºC |
|---|
| Exact Mass | 290.18800 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 3.65370 |
|---|
| Index of Refraction | 1.526 |
|---|
| InChIKey | ARZBHIWSBXERKM-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)COC(=O)C(O)(c1ccccc1)C1CCCCC1 |
|---|
Safety Information
Customs
| HS Code | 2918199090 |
|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| Ibuverine |
| Ibuverino |
| Ibuverine [INN] |
| Hexahydrobenzilsaeureisobutylester |
| Ibuverinum |
