Introduction：Basic information about CAS 61343-44-0|Tocofenoxate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Tocofenoxate |
|---|
| CAS Number | 61343-44-0 | Molecular Weight | 599.28300 |
|---|
| Density | 1.029g/cm3 | Boiling Point | 657.4ºC at 760 mmHg |
|---|
| Molecular Formula | C37H55ClO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 156.7ºC |
|---|
Names
Chemical & Physical Properties
| Density | 1.029g/cm3 |
|---|
| Boiling Point | 657.4ºC at 760 mmHg |
|---|
| Molecular Formula | C37H55ClO4 |
|---|
| Molecular Weight | 599.28300 |
|---|
| Flash Point | 156.7ºC |
|---|
| Exact Mass | 598.37900 |
|---|
| PSA | 44.76000 |
|---|
| LogP | 10.77240 |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | BSKVVWMQRIUXTP-UHFFFAOYSA-N |
|---|
| SMILES | Cc1c(C)c2c(c(C)c1OC(=O)COc1ccc(Cl)cc1)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
|---|
