Introduction：Basic information about CAS 169677-20-7|4-(2-methylbutan-2-yl)benzenesulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-methylbutan-2-yl)benzenesulfonyl chloride |
|---|
| CAS Number | 169677-20-7 | Molecular Weight | 246.75400 |
|---|
| Density | 1.179g/cm3 | Boiling Point | 311.4ºC at 760mmHg |
|---|
| Molecular Formula | C11H15ClO2S | Melting Point | 44-49ºC |
|---|
| MSDS | / | Flash Point | 142.1ºC |
|---|
Names
| Name | 4-(2-methylbutan-2-yl)benzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.179g/cm3 |
|---|
| Boiling Point | 311.4ºC at 760mmHg |
|---|
| Melting Point | 44-49ºC |
|---|
| Molecular Formula | C11H15ClO2S |
|---|
| Molecular Weight | 246.75400 |
|---|
| Flash Point | 142.1ºC |
|---|
| Exact Mass | 246.04800 |
|---|
| PSA | 42.52000 |
|---|
| LogP | 4.38250 |
|---|
| Vapour Pressure | 0.001mmHg at 25°C |
|---|
| Index of Refraction | 1.519 |
|---|
| InChIKey | WLBQFZZPRWQTGR-UHFFFAOYSA-N |
|---|
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)Cl)cc1 |
|---|
Safety Information
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
| HS Code | 2904909090 |
|---|
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 4-tert-Pentyl-benzolsulfonylchlorid |
| 4-(1,1-dimethylpropyl)benzenesulfonyl chloride |
| MFCD00041509 |
| 4-tert-amylbenzene-sulfonyl chloride |
| 4-tert-pentyl-benzenesulfonyl chloride |
| 4-t-pentylbenzenesulfonyl chloride |
| 4-Tert-AmYl-Benzenesulphonyl Chloride |
