Introduction：Basic information about CAS 39239-77-5|1,1,2,2-Tetrahydroperfluoro-1-tetradecanol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,1,2,2-Tetrahydroperfluoro-1-tetradecanol |
|---|
| CAS Number | 39239-77-5 | Molecular Weight | 664.14900 |
|---|
| Density | 1.686g/cm3 | Boiling Point | 254.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H5F25O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 107.8ºC |
|---|
Names
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.686g/cm3 |
|---|
| Boiling Point | 254.6ºC at 760mmHg |
|---|
| Molecular Formula | C14H5F25O |
|---|
| Molecular Weight | 664.14900 |
|---|
| Flash Point | 107.8ºC |
|---|
| Exact Mass | 663.99400 |
|---|
| PSA | 20.23000 |
|---|
| LogP | 7.91940 |
|---|
| Index of Refraction | 1.293 |
|---|
| InChIKey | QBBJBWKVSJWYQK-UHFFFAOYSA-N |
|---|
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
|---|
Synonyms
| 2-Perfluorododecyl ethyl alcohol |
| EINECS 254-373-1 |
| C12F25CH2CH2OH |
| 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-pentacosafluorotetradecanol |
| 1H,1H,2H,2H-perfluorotetradecan-1-ol |
| 1H,1H,2H,2H-perfluorobutadecan-1-ol |
