Introduction：Basic information about CAS 612-43-1|3-(2-Nitro-phenyl)-acrylic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-(2-Nitro-phenyl)-acrylic acid methyl ester |
|---|
| CAS Number | 612-43-1 | Molecular Weight | 207.18300 |
|---|
| Density | 1.277g/cm3 | Boiling Point | 343.3ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9NO4 | Melting Point | 72 °C |
|---|
| MSDS | / | Flash Point | 160.9ºC |
|---|
Names
| Name | methyl (E)-3-(2-nitrophenyl)prop-2-enoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.277g/cm3 |
|---|
| Boiling Point | 343.3ºC at 760 mmHg |
|---|
| Melting Point | 72 °C |
|---|
| Molecular Formula | C10H9NO4 |
|---|
| Molecular Weight | 207.18300 |
|---|
| Flash Point | 160.9ºC |
|---|
| Exact Mass | 207.05300 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 2.30420 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | VKKNUVQQEHKTCG-VOTSOKGWSA-N |
|---|
| SMILES | COC(=O)C=Cc1ccccc1[N+](=O)[O-] |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| nitrobenzamide |
| methyl o-nitrocinnamate |
| methyl 2-nitrocinnamate |
| 2-Carbamoylnitrobenzene |
| 2-Nitro-zimtsaeure-methylester |
| Benzamide,2-nitro |
| O-NITROBENZAMIDE |
| orthonitrocinnamate de methyle |
| Benzamide,o-nitro |
| ortho-nitrobenzamide |
| m-nitrobenzamide |
| 2-nitro-cinnamic acid methyl ester |
| nitrophenylcarboxamide |
| 2-nitro-benzamide |
